C35H54N2O3 — CID 67738996
1-[2-[[(8R,9R,10R,13S,14S)-17-(furan-3-yl)-10,13-dimethyl-3-(2-pyrrolidin-1-ylethoxy)-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]oxy]ethyl]pyrrolidine (PubChem CID 67738996) has the molecular formula C35H54N2O3 and a molecular weight of 550.83 g/mol. Its IUPAC name is 1-[2-[[(8R,9R,10R,13S,14S)-17-(furan-3-yl)-10,13-dimethyl-3-(2-pyrrolidin-1-ylethoxy)-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]oxy]ethyl]pyrrolidine.
| Compound Name | 1-[2-[[(8R,9R,10R,13S,14S)-17-(furan-3-yl)-10,13-dimethyl-3-(2-pyrrolidin-1-ylethoxy)-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]oxy]ethyl]pyrrolidine |
|---|---|
| PubChem CID | 67738996 |
| Molecular Formula | C35H54N2O3 |
| Molecular Weight | 550.83 g/mol |
| Exact Mass | 550.41 |
| IUPAC Name | 1-[2-[[(8R,9R,10R,13S,14S)-17-(furan-3-yl)-10,13-dimethyl-3-(2-pyrrolidin-1-ylethoxy)-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]oxy]ethyl]pyrrolidine |
| SMILES | C[C@]12CCC(OCCN3CCCC3)CC1=CC[C@@H]1[C@H]2CC[C@@]2(C)[C@H]1CCC2(OCCN1CCCC1)c1ccoc1 |
| InChI | InChI=1S/C35H54N2O3/c1-33-13-9-29(39-23-20-36-16-3-4-17-36)25-27(33)7-8-30-31(33)10-14-34(2)32(30)11-15-35(34,28-12-22-38-26-28)40-24-21-37-18-5-6-19-37/h7,12,22,26,29-32H,3-6,8-11,13-21,23-25H2,1-2H3/t29?,30-,31-,32+,33+,34+,35?/m1/s1 |
| InChIKey | CDNMEOIYSNKJOV-QJBKMOBMSA-N |
| XLogP | 7.03 |
| TPSA | 38.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.83 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|