C33H48ClNO3 — CID 67739105
(8R,9R,10R,13S,14S)-17-(4-chlorophenyl)-10,13-dimethyl-3-[2-(2-pyrrolidin-1-ylethoxy)ethoxy]-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 67739105) has the molecular formula C33H48ClNO3 and a molecular weight of 542.20 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-17-(4-chlorophenyl)-10,13-dimethyl-3-[2-(2-pyrrolidin-1-ylethoxy)ethoxy]-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (8R,9R,10R,13S,14S)-17-(4-chlorophenyl)-10,13-dimethyl-3-[2-(2-pyrrolidin-1-ylethoxy)ethoxy]-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 67739105 |
| Molecular Formula | C33H48ClNO3 |
| Molecular Weight | 542.20 g/mol |
| Exact Mass | 541.33 |
| IUPAC Name | (8R,9R,10R,13S,14S)-17-(4-chlorophenyl)-10,13-dimethyl-3-[2-(2-pyrrolidin-1-ylethoxy)ethoxy]-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | C[C@]12CCC(OCCOCCN3CCCC3)CC1=CC[C@@H]1[C@H]2CC[C@@]2(C)[C@H]1CCC2(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C33H48ClNO3/c1-31-14-11-27(38-22-21-37-20-19-35-17-3-4-18-35)23-25(31)7-10-28-29(31)12-15-32(2)30(28)13-16-33(32,36)24-5-8-26(34)9-6-24/h5-9,27-30,36H,3-4,10-23H2,1-2H3/t27?,28-,29-,30+,31+,32+,33?/m1/s1 |
| InChIKey | VLLVZNVDWVUTMA-PLYUMZDZSA-N |
| XLogP | 6.99 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.20 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|