C29H43NO3 — CID 25424893
[(3S,8S,9R,10R,13S,14R)-17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-piperidin-1-ylpropanoate (PubChem CID 25424893) has the molecular formula C29H43NO3 and a molecular weight of 453.67 g/mol. Its IUPAC name is [(3S,8S,9R,10R,13S,14R)-17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-piperidin-1-ylpropanoate.
| Compound Name | [(3S,8S,9R,10R,13S,14R)-17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-piperidin-1-ylpropanoate |
|---|---|
| PubChem CID | 25424893 |
| Molecular Formula | C29H43NO3 |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 453.32 |
| IUPAC Name | [(3S,8S,9R,10R,13S,14R)-17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-piperidin-1-ylpropanoate |
| SMILES | CC(=O)C1=CC[C@@H]2[C@H]3CC=C4C[C@@H](OC(=O)CCN5CCCCC5)CC[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C29H43NO3/c1-20(31)24-9-10-25-23-8-7-21-19-22(33-27(32)13-18-30-16-5-4-6-17-30)11-14-28(21,2)26(23)12-15-29(24,25)3/h7,9,22-23,25-26H,4-6,8,10-19H2,1-3H3/t22-,23+,25+,26+,28-,29+/m0/s1 |
| InChIKey | GFSADSWYLWESJW-ZDWGSTEKSA-N |
| XLogP | 5.86 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|