C31H47NO3 — CID 135639135
[(10R,13S)-17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-(3,3-dimethylpiperidin-1-yl)propanoate (PubChem CID 135639135) has the molecular formula C31H47NO3 and a molecular weight of 481.72 g/mol. Its IUPAC name is [(10R,13S)-17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-(3,3-dimethylpiperidin-1-yl)propanoate.
| Compound Name | [(10R,13S)-17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-(3,3-dimethylpiperidin-1-yl)propanoate |
|---|---|
| PubChem CID | 135639135 |
| Molecular Formula | C31H47NO3 |
| Molecular Weight | 481.72 g/mol |
| Exact Mass | 481.36 |
| IUPAC Name | [(10R,13S)-17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-(3,3-dimethylpiperidin-1-yl)propanoate |
| SMILES | CC(=O)C1=CCC2C3CC=C4CC(OC(=O)CCN5CCCC(C)(C)C5)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C31H47NO3/c1-21(33)25-9-10-26-24-8-7-22-19-23(11-15-30(22,4)27(24)12-16-31(25,26)5)35-28(34)13-18-32-17-6-14-29(2,3)20-32/h7,9,23-24,26-27H,6,8,10-20H2,1-5H3/t23?,24?,26?,27?,30-,31+/m0/s1 |
| InChIKey | XRKFVYSOSJXHRG-MWJFHSLWSA-N |
| XLogP | 6.50 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.72 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|