C30H47NO4 — CID 3790102
(17-acetyl-17-hydroxy-10,13,16-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl) 3-piperidin-1-ylpropanoate (PubChem CID 3790102) has the molecular formula C30H47NO4 and a molecular weight of 485.71 g/mol. Its IUPAC name is (17-acetyl-17-hydroxy-10,13,16-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl) 3-piperidin-1-ylpropanoate.
| Compound Name | (17-acetyl-17-hydroxy-10,13,16-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl) 3-piperidin-1-ylpropanoate |
|---|---|
| PubChem CID | 3790102 |
| Molecular Formula | C30H47NO4 |
| Molecular Weight | 485.71 g/mol |
| Exact Mass | 485.35 |
| IUPAC Name | (17-acetyl-17-hydroxy-10,13,16-trimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl) 3-piperidin-1-ylpropanoate |
| SMILES | CC(=O)C1(O)C(C)CC2C3CC=C4CC(OC(=O)CCN5CCCCC5)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C30H47NO4/c1-20-18-26-24-9-8-22-19-23(35-27(33)12-17-31-15-6-5-7-16-31)10-13-28(22,3)25(24)11-14-29(26,4)30(20,34)21(2)32/h8,20,23-26,34H,5-7,9-19H2,1-4H3 |
| InChIKey | YFNPVWRSYRXVRN-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.71 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|