C24H36N4O — CID 91518173
2-[[(5R,8R,9S,10S,13S,14R,17R)-17-(furan-3-yl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ylidene]amino]guanidine (PubChem CID 91518173) has the molecular formula C24H36N4O and a molecular weight of 396.58 g/mol. Its IUPAC name is 2-[[(5R,8R,9S,10S,13S,14R,17R)-17-(furan-3-yl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ylidene]amino]guanidine.
| Compound Name | 2-[[(5R,8R,9S,10S,13S,14R,17R)-17-(furan-3-yl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ylidene]amino]guanidine |
|---|---|
| PubChem CID | 91518173 |
| Molecular Formula | C24H36N4O |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | 2-[[(5R,8R,9S,10S,13S,14R,17R)-17-(furan-3-yl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ylidene]amino]guanidine |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC[C@@H]4CC(=NN=C(N)N)CC[C@@]43C)[C@H]1CC[C@H]2c1ccoc1 |
| InChI | InChI=1S/C24H36N4O/c1-23-10-7-17(27-28-22(25)26)13-16(23)3-4-18-20-6-5-19(15-9-12-29-14-15)24(20,2)11-8-21(18)23/h9,12,14,16,18-21H,3-8,10-11,13H2,1-2H3,(H4,25,26,28)/t16-,18+,19+,20-,21+,23+,24-/m1/s1 |
| InChIKey | WQDPDYXXURDKHL-OHGRCXDGSA-N |
| XLogP | 5.04 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|