C21H32O2S — CID 56981335
(8R,9R,10R,13S,14S)-3-(2-hydroxyethylsulfanyl)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 56981335) has the molecular formula C21H32O2S and a molecular weight of 348.55 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-3-(2-hydroxyethylsulfanyl)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9R,10R,13S,14S)-3-(2-hydroxyethylsulfanyl)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 56981335 |
| Molecular Formula | C21H32O2S |
| Molecular Weight | 348.55 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | (8R,9R,10R,13S,14S)-3-(2-hydroxyethylsulfanyl)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CCC(SCCO)CC1=CC[C@@H]1[C@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C21H32O2S/c1-20-9-7-15(24-12-11-22)13-14(20)3-4-16-17-5-6-19(23)21(17,2)10-8-18(16)20/h3,15-18,22H,4-13H2,1-2H3/t15?,16-,17-,18+,20-,21-/m0/s1 |
| InChIKey | NJUNVNCLFKASLU-OYUJZYAMSA-N |
| XLogP | 4.61 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|