C31H45NO6S — CID 70044210
(3S,8R,9S,10R,13R,14S,17R)-17-(furan-3-yl)-10,13-dimethyl-3-(2-pyrrolidin-1-ylethylsulfanyl)-1,2,3,4,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-14-ol;oxalic acid (PubChem CID 70044210) has the molecular formula C31H45NO6S and a molecular weight of 559.77 g/mol. Its IUPAC name is (3S,8R,9S,10R,13R,14S,17R)-17-(furan-3-yl)-10,13-dimethyl-3-(2-pyrrolidin-1-ylethylsulfanyl)-1,2,3,4,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-14-ol;oxalic acid.
| Compound Name | (3S,8R,9S,10R,13R,14S,17R)-17-(furan-3-yl)-10,13-dimethyl-3-(2-pyrrolidin-1-ylethylsulfanyl)-1,2,3,4,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-14-ol;oxalic acid |
|---|---|
| PubChem CID | 70044210 |
| Molecular Formula | C31H45NO6S |
| Molecular Weight | 559.77 g/mol |
| Exact Mass | 559.30 |
| IUPAC Name | (3S,8R,9S,10R,13R,14S,17R)-17-(furan-3-yl)-10,13-dimethyl-3-(2-pyrrolidin-1-ylethylsulfanyl)-1,2,3,4,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-14-ol;oxalic acid |
| SMILES | C[C@]12CC[C@H](SCCN3CCCC3)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](c3ccoc3)CC[C@]12O.O=C(O)C(=O)O |
| InChI | InChI=1S/C29H43NO2S.C2H2O4/c1-27-11-7-23(33-18-16-30-14-3-4-15-30)19-22(27)5-6-26-25(27)8-12-28(2)24(9-13-29(26,28)31)21-10-17-32-20-21;3-1(4)2(5)6/h5,10,17,20,23-26,31H,3-4,6-9,11-16,18-19H2,1-2H3;(H,3,4)(H,5,6)/t23-,24+,25-,26+,27-,28+,29-;/m0./s1 |
| InChIKey | ATSMAEYBUVFPPD-NYIDREBYSA-N |
| XLogP | 5.79 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.77 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|