C15H23FO3 — CID 46218502
(3aR,5aS,9aS,9bR)-9b-fluoro-3a-hydroxy-6,6,9a-trimethyl-4,5,5a,7,8,9-hexahydro-1H-benzo[e][2]benzofuran-3-one (PubChem CID 46218502) has the molecular formula C15H23FO3 and a molecular weight of 270.34 g/mol. Its IUPAC name is (3aR,5aS,9aS,9bR)-9b-fluoro-3a-hydroxy-6,6,9a-trimethyl-4,5,5a,7,8,9-hexahydro-1H-benzo[e][2]benzofuran-3-one.
| Compound Name | (3aR,5aS,9aS,9bR)-9b-fluoro-3a-hydroxy-6,6,9a-trimethyl-4,5,5a,7,8,9-hexahydro-1H-benzo[e][2]benzofuran-3-one |
|---|---|
| PubChem CID | 46218502 |
| Molecular Formula | C15H23FO3 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | (3aR,5aS,9aS,9bR)-9b-fluoro-3a-hydroxy-6,6,9a-trimethyl-4,5,5a,7,8,9-hexahydro-1H-benzo[e][2]benzofuran-3-one |
| SMILES | CC1(C)CCC[C@@]2(C)[C@H]1CC[C@@]1(O)C(=O)OC[C@@]12F |
| InChI | InChI=1S/C15H23FO3/c1-12(2)6-4-7-13(3)10(12)5-8-14(18)11(17)19-9-15(13,14)16/h10,18H,4-9H2,1-3H3/t10-,13-,14+,15-/m0/s1 |
| InChIKey | FWFXTTLJPRTESK-HPEDKQMDSA-N |
| XLogP | 2.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |