C20H32O — CID 98136961
(1S,2S,7R,10R,12S)-2,6,6,10,12-pentamethyltetracyclo[10.2.1.01,10.02,7]pentadecan-11-one (PubChem CID 98136961) has the molecular formula C20H32O and a molecular weight of 288.47 g/mol. Its IUPAC name is (1S,2S,7R,10R,12S)-2,6,6,10,12-pentamethyltetracyclo[10.2.1.01,10.02,7]pentadecan-11-one.
| Compound Name | (1S,2S,7R,10R,12S)-2,6,6,10,12-pentamethyltetracyclo[10.2.1.01,10.02,7]pentadecan-11-one |
|---|---|
| PubChem CID | 98136961 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.47 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | (1S,2S,7R,10R,12S)-2,6,6,10,12-pentamethyltetracyclo[10.2.1.01,10.02,7]pentadecan-11-one |
| SMILES | CC1(C)CCC[C@@]2(C)[C@@H]1CC[C@@]1(C)C(=O)[C@@]3(C)CC[C@@]12C3 |
| InChI | InChI=1S/C20H32O/c1-16(2)8-6-9-18(4)14(16)7-10-19(5)15(21)17(3)11-12-20(18,19)13-17/h14H,6-13H2,1-5H3/t14-,17+,18+,19+,20+/m1/s1 |
| InChIKey | KQWRECMMRGLTCH-SSRYDLFMSA-N |
| XLogP | 5.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.47 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |