C20H30O — CID 15547291
(1S,2S,7S,13R)-2,6,6,13-tetramethyltetracyclo[11.2.1.01,10.02,7]hexadec-10-en-12-one (PubChem CID 15547291) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is (1S,2S,7S,13R)-2,6,6,13-tetramethyltetracyclo[11.2.1.01,10.02,7]hexadec-10-en-12-one.
| Compound Name | (1S,2S,7S,13R)-2,6,6,13-tetramethyltetracyclo[11.2.1.01,10.02,7]hexadec-10-en-12-one |
|---|---|
| PubChem CID | 15547291 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (1S,2S,7S,13R)-2,6,6,13-tetramethyltetracyclo[11.2.1.01,10.02,7]hexadec-10-en-12-one |
| SMILES | CC1(C)CCC[C@@]2(C)[C@H]1CCC1=CC(=O)[C@]3(C)CC[C@]12C3 |
| InChI | InChI=1S/C20H30O/c1-17(2)8-5-9-19(4)15(17)7-6-14-12-16(21)18(3)10-11-20(14,19)13-18/h12,15H,5-11,13H2,1-4H3/t15-,18+,19-,20-/m0/s1 |
| InChIKey | RKGCTEFQTMJNIN-LDTOTXGLSA-N |
| XLogP | 5.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |