C21H36O3 — CID 24786644
methyl 5-[(1aS,3aS,7aS,7bR)-1a,4,4,7a-tetramethyl-2,3,3a,5,6,7-hexahydronaphtho[1,2-b]oxiren-7b-yl]-3-methylpentanoate (PubChem CID 24786644) has the molecular formula C21H36O3 and a molecular weight of 336.52 g/mol. Its IUPAC name is methyl 5-[(1aS,3aS,7aS,7bR)-1a,4,4,7a-tetramethyl-2,3,3a,5,6,7-hexahydronaphtho[1,2-b]oxiren-7b-yl]-3-methylpentanoate.
| Compound Name | methyl 5-[(1aS,3aS,7aS,7bR)-1a,4,4,7a-tetramethyl-2,3,3a,5,6,7-hexahydronaphtho[1,2-b]oxiren-7b-yl]-3-methylpentanoate |
|---|---|
| PubChem CID | 24786644 |
| Molecular Formula | C21H36O3 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.27 |
| IUPAC Name | methyl 5-[(1aS,3aS,7aS,7bR)-1a,4,4,7a-tetramethyl-2,3,3a,5,6,7-hexahydronaphtho[1,2-b]oxiren-7b-yl]-3-methylpentanoate |
| SMILES | COC(=O)CC(C)CC[C@]12O[C@@]1(C)CC[C@H]1C(C)(C)CCC[C@@]12C |
| InChI | InChI=1S/C21H36O3/c1-15(14-17(22)23-6)8-13-21-19(4)11-7-10-18(2,3)16(19)9-12-20(21,5)24-21/h15-16H,7-14H2,1-6H3/t15?,16-,19-,20-,21+/m0/s1 |
| InChIKey | SMKUSMSJNAXXQU-ONTSXIIYSA-N |
| XLogP | 5.12 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|