C21H38O5 — CID 10022084
methyl (3R)-5-[(1S,2R,4aR,5R,6S,7R,8aR)-5,6,7-trihydroxy-1,2,4a,5-tetramethyl-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-methylpentanoate (PubChem CID 10022084) has the molecular formula C21H38O5 and a molecular weight of 370.53 g/mol. Its IUPAC name is methyl (3R)-5-[(1S,2R,4aR,5R,6S,7R,8aR)-5,6,7-trihydroxy-1,2,4a,5-tetramethyl-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-methylpentanoate.
| Compound Name | methyl (3R)-5-[(1S,2R,4aR,5R,6S,7R,8aR)-5,6,7-trihydroxy-1,2,4a,5-tetramethyl-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-methylpentanoate |
|---|---|
| PubChem CID | 10022084 |
| Molecular Formula | C21H38O5 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | methyl (3R)-5-[(1S,2R,4aR,5R,6S,7R,8aR)-5,6,7-trihydroxy-1,2,4a,5-tetramethyl-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-methylpentanoate |
| SMILES | COC(=O)C[C@H](C)CC[C@@]1(C)[C@H](C)CC[C@]2(C)[C@@H]1C[C@@H](O)[C@H](O)[C@]2(C)O |
| InChI | InChI=1S/C21H38O5/c1-13(11-17(23)26-6)7-9-19(3)14(2)8-10-20(4)16(19)12-15(22)18(24)21(20,5)25/h13-16,18,22,24-25H,7-12H2,1-6H3/t13-,14-,15-,16-,18+,19+,20-,21+/m1/s1 |
| InChIKey | RLIDANZRUPSFBE-GNWRFUQESA-N |
| XLogP | 2.90 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |