C26H44O5 — CID 162945936
methyl 5-[5-hydroxy-1,2,4a,5-tetramethyl-4-(2-methylbut-2-enoyloxy)-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-methylpentanoate (PubChem CID 162945936) has the molecular formula C26H44O5 and a molecular weight of 436.63 g/mol. Its IUPAC name is methyl 5-[5-hydroxy-1,2,4a,5-tetramethyl-4-(2-methylbut-2-enoyloxy)-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-methylpentanoate.
| Compound Name | methyl 5-[5-hydroxy-1,2,4a,5-tetramethyl-4-(2-methylbut-2-enoyloxy)-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-methylpentanoate |
|---|---|
| PubChem CID | 162945936 |
| Molecular Formula | C26H44O5 |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.32 |
| IUPAC Name | methyl 5-[5-hydroxy-1,2,4a,5-tetramethyl-4-(2-methylbut-2-enoyloxy)-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-methylpentanoate |
| SMILES | CC=C(C)C(=O)OC1CC(C)C(C)(CCC(C)CC(=O)OC)C2CCCC(C)(O)C12C |
| InChI | InChI=1S/C26H44O5/c1-9-18(3)23(28)31-21-16-19(4)24(5,14-12-17(2)15-22(27)30-8)20-11-10-13-25(6,29)26(20,21)7/h9,17,19-21,29H,10-16H2,1-8H3 |
| InChIKey | KWNPEEITGNXZLF-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|