C11H20S — CID 88900416
(5,5-dimethyl-1-bicyclo[4.2.0]octanyl)methanethiol (PubChem CID 88900416) has the molecular formula C11H20S and a molecular weight of 184.35 g/mol. Its IUPAC name is (5,5-dimethyl-1-bicyclo[4.2.0]octanyl)methanethiol.
| Compound Name | (5,5-dimethyl-1-bicyclo[4.2.0]octanyl)methanethiol |
|---|---|
| PubChem CID | 88900416 |
| Molecular Formula | C11H20S |
| Molecular Weight | 184.35 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | (5,5-dimethyl-1-bicyclo[4.2.0]octanyl)methanethiol |
| SMILES | CC1(C)CCCC2(CS)CCC12 |
| InChI | InChI=1S/C11H20S/c1-10(2)5-3-6-11(8-12)7-4-9(10)11/h9,12H,3-8H2,1-2H3 |
| InChIKey | ZPCAGMFCJJBJOL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|