C18H32O2 — CID 53236772
(2R,4aR,4bS,8aS,10aR)-2,4b,8,8-tetramethyl-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene-2,10a-diol (PubChem CID 53236772) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is (2R,4aR,4bS,8aS,10aR)-2,4b,8,8-tetramethyl-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene-2,10a-diol.
| Compound Name | (2R,4aR,4bS,8aS,10aR)-2,4b,8,8-tetramethyl-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene-2,10a-diol |
|---|---|
| PubChem CID | 53236772 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | (2R,4aR,4bS,8aS,10aR)-2,4b,8,8-tetramethyl-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene-2,10a-diol |
| SMILES | CC1(C)CCC[C@@]2(C)[C@H]1CC[C@@]1(O)C[C@](C)(O)CC[C@@H]12 |
| InChI | InChI=1S/C18H32O2/c1-15(2)8-5-9-17(4)13(15)7-11-18(20)12-16(3,19)10-6-14(17)18/h13-14,19-20H,5-12H2,1-4H3/t13-,14+,16+,17-,18+/m0/s1 |
| InChIKey | DQWNACLPIWJSGJ-XGAARHLOSA-N |
| XLogP | 3.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |