C23H33ClO2 — CID 53236776
(2R,4aR,4bS,8aS,10aR)-2-(4-chlorophenyl)-4b,8,8-trimethyl-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene-2,10a-diol (PubChem CID 53236776) has the molecular formula C23H33ClO2 and a molecular weight of 376.97 g/mol. Its IUPAC name is (2R,4aR,4bS,8aS,10aR)-2-(4-chlorophenyl)-4b,8,8-trimethyl-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene-2,10a-diol.
| Compound Name | (2R,4aR,4bS,8aS,10aR)-2-(4-chlorophenyl)-4b,8,8-trimethyl-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene-2,10a-diol |
|---|---|
| PubChem CID | 53236776 |
| Molecular Formula | C23H33ClO2 |
| Molecular Weight | 376.97 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (2R,4aR,4bS,8aS,10aR)-2-(4-chlorophenyl)-4b,8,8-trimethyl-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene-2,10a-diol |
| SMILES | CC1(C)CCC[C@@]2(C)[C@H]1CC[C@@]1(O)C[C@@](O)(c3ccc(Cl)cc3)CC[C@@H]12 |
| InChI | InChI=1S/C23H33ClO2/c1-20(2)11-4-12-21(3)18(20)9-14-23(26)15-22(25,13-10-19(21)23)16-5-7-17(24)8-6-16/h5-8,18-19,25-26H,4,9-15H2,1-3H3/t18-,19+,21-,22+,23+/m0/s1 |
| InChIKey | PXDAPICCNOFBOF-RNJSZURPSA-N |
| XLogP | 5.69 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.97 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |