C27H48 — CID 162856905
(4aS,4bR,6aR,7S,10aR,10bR,12aS)-1,1,4a,7,10a,10b-hexamethyl-7-propyl-3,4,4b,5,6,6a,8,9,10,11,12,12a-dodecahydro-2H-chrysene (PubChem CID 162856905) has the molecular formula C27H48 and a molecular weight of 372.68 g/mol. Its IUPAC name is (4aS,4bR,6aR,7S,10aR,10bR,12aS)-1,1,4a,7,10a,10b-hexamethyl-7-propyl-3,4,4b,5,6,6a,8,9,10,11,12,12a-dodecahydro-2H-chrysene.
| Compound Name | (4aS,4bR,6aR,7S,10aR,10bR,12aS)-1,1,4a,7,10a,10b-hexamethyl-7-propyl-3,4,4b,5,6,6a,8,9,10,11,12,12a-dodecahydro-2H-chrysene |
|---|---|
| PubChem CID | 162856905 |
| Molecular Formula | C27H48 |
| Molecular Weight | 372.68 g/mol |
| Exact Mass | 372.38 |
| IUPAC Name | (4aS,4bR,6aR,7S,10aR,10bR,12aS)-1,1,4a,7,10a,10b-hexamethyl-7-propyl-3,4,4b,5,6,6a,8,9,10,11,12,12a-dodecahydro-2H-chrysene |
| SMILES | CCC[C@@]1(C)CCC[C@]2(C)[C@@H]1CC[C@@H]1[C@@]3(C)CCCC(C)(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C27H48/c1-8-14-24(4)16-10-18-26(6)21(24)11-12-22-25(5)17-9-15-23(2,3)20(25)13-19-27(22,26)7/h20-22H,8-19H2,1-7H3/t20-,21+,22+,24-,25-,26+,27+/m0/s1 |
| InChIKey | PLFOYKFPFYCBNQ-ZEFLZXIKSA-N |
| XLogP | 8.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.68 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |