C28H48O — CID 101248968
(4aS,6aR,6aR,6bR,8aS,12aS,14aR,14bS)-6a,6b,9,9,12a,14b-hexamethyl-2,3,4,4a,5,6,6a,7,8,8a,10,11,12,13,14,14a-hexadecahydro-1H-picen-3-ol (PubChem CID 101248968) has the molecular formula C28H48O and a molecular weight of 400.69 g/mol. Its IUPAC name is (4aS,6aR,6aR,6bR,8aS,12aS,14aR,14bS)-6a,6b,9,9,12a,14b-hexamethyl-2,3,4,4a,5,6,6a,7,8,8a,10,11,12,13,14,14a-hexadecahydro-1H-picen-3-ol.
| Compound Name | (4aS,6aR,6aR,6bR,8aS,12aS,14aR,14bS)-6a,6b,9,9,12a,14b-hexamethyl-2,3,4,4a,5,6,6a,7,8,8a,10,11,12,13,14,14a-hexadecahydro-1H-picen-3-ol |
|---|---|
| PubChem CID | 101248968 |
| Molecular Formula | C28H48O |
| Molecular Weight | 400.69 g/mol |
| Exact Mass | 400.37 |
| IUPAC Name | (4aS,6aR,6aR,6bR,8aS,12aS,14aR,14bS)-6a,6b,9,9,12a,14b-hexamethyl-2,3,4,4a,5,6,6a,7,8,8a,10,11,12,13,14,14a-hexadecahydro-1H-picen-3-ol |
| SMILES | CC1(C)CCC[C@]2(C)[C@H]3CC[C@@H]4[C@@]5(C)CCC(O)C[C@@H]5CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C28H48O/c1-24(2)13-7-14-26(4)21(24)12-17-28(6)23(26)9-8-22-25(3)15-11-20(29)18-19(25)10-16-27(22,28)5/h19-23,29H,7-18H2,1-6H3/t19-,20?,21-,22+,23+,25-,26-,27+,28+/m0/s1 |
| InChIKey | NWIQBHSWOHMWLR-PPJJQSGJSA-N |
| XLogP | 7.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.69 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |