C10H15BrO4 — CID 12944769
5-[5-(bromomethyl)-5-hydroxyoxolan-2-yl]-5-methyloxolan-2-one (PubChem CID 12944769) has the molecular formula C10H15BrO4 and a molecular weight of 279.13 g/mol. Its IUPAC name is 5-[5-(bromomethyl)-5-hydroxyoxolan-2-yl]-5-methyloxolan-2-one.
| Compound Name | 5-[5-(bromomethyl)-5-hydroxyoxolan-2-yl]-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 12944769 |
| Molecular Formula | C10H15BrO4 |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | 5-[5-(bromomethyl)-5-hydroxyoxolan-2-yl]-5-methyloxolan-2-one |
| SMILES | CC1(C2CCC(O)(CBr)O2)CCC(=O)O1 |
| InChI | InChI=1S/C10H15BrO4/c1-9(4-3-8(12)15-9)7-2-5-10(13,6-11)14-7/h7,13H,2-6H2,1H3 |
| InChIKey | QZNDDZXGAGQACE-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|