C22H30O4 — CID 163081021
(5S)-5-[(2R,5R)-5-[7-(furan-3-yl)-4-methylhepta-1,4-dienyl]-5-methyloxolan-2-yl]-5-methyloxolan-2-one (PubChem CID 163081021) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is (5S)-5-[(2R,5R)-5-[7-(furan-3-yl)-4-methylhepta-1,4-dienyl]-5-methyloxolan-2-yl]-5-methyloxolan-2-one.
| Compound Name | (5S)-5-[(2R,5R)-5-[7-(furan-3-yl)-4-methylhepta-1,4-dienyl]-5-methyloxolan-2-yl]-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 163081021 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | (5S)-5-[(2R,5R)-5-[7-(furan-3-yl)-4-methylhepta-1,4-dienyl]-5-methyloxolan-2-yl]-5-methyloxolan-2-one |
| SMILES | CC(=CCCc1ccoc1)CC=C[C@@]1(C)CC[C@H]([C@]2(C)CCC(=O)O2)O1 |
| InChI | InChI=1S/C22H30O4/c1-17(6-4-8-18-11-15-24-16-18)7-5-12-21(2)13-9-19(25-21)22(3)14-10-20(23)26-22/h5-6,11-12,15-16,19H,4,7-10,13-14H2,1-3H3/t19-,21+,22+/m1/s1 |
| InChIKey | KJTXBIXWWIZNLF-HJNYFJLDSA-N |
| XLogP | 5.14 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|