C20H32O2 — CID 5387251
(2S)-2-[(E)-6-(furan-3-yl)-3-methylhex-3-enyl]-1,3,3-trimethylcyclohexan-1-ol (PubChem CID 5387251) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (2S)-2-[(E)-6-(furan-3-yl)-3-methylhex-3-enyl]-1,3,3-trimethylcyclohexan-1-ol.
| Compound Name | (2S)-2-[(E)-6-(furan-3-yl)-3-methylhex-3-enyl]-1,3,3-trimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 5387251 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (2S)-2-[(E)-6-(furan-3-yl)-3-methylhex-3-enyl]-1,3,3-trimethylcyclohexan-1-ol |
| SMILES | C/C(=C\CCc1ccoc1)CC[C@H]1C(C)(C)CCCC1(C)O |
| InChI | InChI=1S/C20H32O2/c1-16(7-5-8-17-11-14-22-15-17)9-10-18-19(2,3)12-6-13-20(18,4)21/h7,11,14-15,18,21H,5-6,8-10,12-13H2,1-4H3/b16-7+/t18-,20?/m0/s1 |
| InChIKey | GWDLJHLACNCUDH-KTDMFQGVSA-N |
| XLogP | 5.52 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|