C20H30O — CID 73196075
3-[4-methyl-6-(2,2,6-trimethylcyclohexylidene)hex-3-enyl]furan (PubChem CID 73196075) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is 3-[4-methyl-6-(2,2,6-trimethylcyclohexylidene)hex-3-enyl]furan.
| Compound Name | 3-[4-methyl-6-(2,2,6-trimethylcyclohexylidene)hex-3-enyl]furan |
|---|---|
| PubChem CID | 73196075 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 3-[4-methyl-6-(2,2,6-trimethylcyclohexylidene)hex-3-enyl]furan |
| SMILES | CC(=CCCc1ccoc1)CC=C1C(C)CCCC1(C)C |
| InChI | InChI=1S/C20H30O/c1-16(7-5-9-18-12-14-21-15-18)10-11-19-17(2)8-6-13-20(19,3)4/h7,11-12,14-15,17H,5-6,8-10,13H2,1-4H3 |
| InChIKey | YJTHRUZPBKMYIC-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|