C21H26O3 — CID 85094348
7-(furan-3-yl)-4-methyl-1-(7-methyl-5,6-dihydro-4H-1-benzofuran-7-yl)hept-4-en-2-one (PubChem CID 85094348) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is 7-(furan-3-yl)-4-methyl-1-(7-methyl-5,6-dihydro-4H-1-benzofuran-7-yl)hept-4-en-2-one.
| Compound Name | 7-(furan-3-yl)-4-methyl-1-(7-methyl-5,6-dihydro-4H-1-benzofuran-7-yl)hept-4-en-2-one |
|---|---|
| PubChem CID | 85094348 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 7-(furan-3-yl)-4-methyl-1-(7-methyl-5,6-dihydro-4H-1-benzofuran-7-yl)hept-4-en-2-one |
| SMILES | CC(=CCCc1ccoc1)CC(=O)CC1(C)CCCc2ccoc21 |
| InChI | InChI=1S/C21H26O3/c1-16(5-3-6-17-8-11-23-15-17)13-19(22)14-21(2)10-4-7-18-9-12-24-20(18)21/h5,8-9,11-12,15H,3-4,6-7,10,13-14H2,1-2H3 |
| InChIKey | NQLMQSZWWCKWNA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|