C25H38O3 — CID 11280638
(6E,10S,14E)-17-(furan-3-yl)-2,6,10,14-tetramethylheptadeca-6,14-diene-4,12-dione (PubChem CID 11280638) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is (6E,10S,14E)-17-(furan-3-yl)-2,6,10,14-tetramethylheptadeca-6,14-diene-4,12-dione.
| Compound Name | (6E,10S,14E)-17-(furan-3-yl)-2,6,10,14-tetramethylheptadeca-6,14-diene-4,12-dione |
|---|---|
| PubChem CID | 11280638 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | (6E,10S,14E)-17-(furan-3-yl)-2,6,10,14-tetramethylheptadeca-6,14-diene-4,12-dione |
| SMILES | C/C(=C\CC[C@H](C)CC(=O)C/C(C)=C/CCc1ccoc1)CC(=O)CC(C)C |
| InChI | InChI=1S/C25H38O3/c1-19(2)14-24(26)15-20(3)8-6-9-21(4)16-25(27)17-22(5)10-7-11-23-12-13-28-18-23/h8,10,12-13,18-19,21H,6-7,9,11,14-17H2,1-5H3/b20-8+,22-10+/t21-/m0/s1 |
| InChIKey | SKUOPEHHKXBWPS-CRIKYYJDSA-N |
| XLogP | 6.88 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|