C21H30O3 — CID 163005288
(6S,8S)-1,11-bis(furan-3-yl)-4,8-dimethylundec-3-en-6-ol (PubChem CID 163005288) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is (6S,8S)-1,11-bis(furan-3-yl)-4,8-dimethylundec-3-en-6-ol.
| Compound Name | (6S,8S)-1,11-bis(furan-3-yl)-4,8-dimethylundec-3-en-6-ol |
|---|---|
| PubChem CID | 163005288 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (6S,8S)-1,11-bis(furan-3-yl)-4,8-dimethylundec-3-en-6-ol |
| SMILES | CC(=CCCc1ccoc1)C[C@@H](O)C[C@@H](C)CCCc1ccoc1 |
| InChI | InChI=1S/C21H30O3/c1-17(5-3-7-19-9-11-23-15-19)13-21(22)14-18(2)6-4-8-20-10-12-24-16-20/h5,9-12,15-16,18,21-22H,3-4,6-8,13-14H2,1-2H3/t18-,21+/m0/s1 |
| InChIKey | SFDYMPBPKHWFDV-GHTZIAJQSA-N |
| XLogP | 5.55 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|