C21H30O5 — CID 163186419
(1S,4R,5R)-4-[(E,6S,8S)-11-(furan-3-yl)-6-hydroxy-4,8-dimethylundec-3-enyl]-2,6-dioxabicyclo[3.1.0]hexan-3-one (PubChem CID 163186419) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is (1S,4R,5R)-4-[(E,6S,8S)-11-(furan-3-yl)-6-hydroxy-4,8-dimethylundec-3-enyl]-2,6-dioxabicyclo[3.1.0]hexan-3-one.
| Compound Name | (1S,4R,5R)-4-[(E,6S,8S)-11-(furan-3-yl)-6-hydroxy-4,8-dimethylundec-3-enyl]-2,6-dioxabicyclo[3.1.0]hexan-3-one |
|---|---|
| PubChem CID | 163186419 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (1S,4R,5R)-4-[(E,6S,8S)-11-(furan-3-yl)-6-hydroxy-4,8-dimethylundec-3-enyl]-2,6-dioxabicyclo[3.1.0]hexan-3-one |
| SMILES | C/C(=C\CC[C@H]1C(=O)O[C@@H]2O[C@@H]21)C[C@@H](O)C[C@@H](C)CCCc1ccoc1 |
| InChI | InChI=1S/C21H30O5/c1-14(5-3-7-16-9-10-24-13-16)11-17(22)12-15(2)6-4-8-18-19-21(25-19)26-20(18)23/h6,9-10,13-14,17-19,21-22H,3-5,7-8,11-12H2,1-2H3/b15-6+/t14-,17-,18+,19+,21-/m0/s1 |
| InChIKey | JHGHZDJBMQZTQN-DBDKBOJFSA-N |
| XLogP | 4.00 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|