C21H30O4 — CID 70697981
(2R,4S)-7-(furan-3-yl)-1-[(2S,3R)-3-[2-(furan-3-yl)ethyl]-2-methyloxiran-2-yl]-4-methylheptan-2-ol (PubChem CID 70697981) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is (2R,4S)-7-(furan-3-yl)-1-[(2S,3R)-3-[2-(furan-3-yl)ethyl]-2-methyloxiran-2-yl]-4-methylheptan-2-ol.
| Compound Name | (2R,4S)-7-(furan-3-yl)-1-[(2S,3R)-3-[2-(furan-3-yl)ethyl]-2-methyloxiran-2-yl]-4-methylheptan-2-ol |
|---|---|
| PubChem CID | 70697981 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (2R,4S)-7-(furan-3-yl)-1-[(2S,3R)-3-[2-(furan-3-yl)ethyl]-2-methyloxiran-2-yl]-4-methylheptan-2-ol |
| SMILES | C[C@@H](CCCc1ccoc1)C[C@@H](O)C[C@]1(C)O[C@@H]1CCc1ccoc1 |
| InChI | InChI=1S/C21H30O4/c1-16(4-3-5-17-8-10-23-14-17)12-19(22)13-21(2)20(25-21)7-6-18-9-11-24-15-18/h8-11,14-16,19-20,22H,3-7,12-13H2,1-2H3/t16-,19+,20+,21-/m0/s1 |
| InChIKey | AUEKROIOGGQZNX-ZXNZYJFHSA-N |
| XLogP | 4.76 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|