About 3-(3-chlorobutyl)furan
3-(3-chlorobutyl)furan (PubChem CID 64514685) has the molecular formula C8H11ClO
and a molecular weight of 158.63 g/mol. Its IUPAC name is 3-(3-chlorobutyl)furan.
Molecular Properties
| Compound Name | 3-(3-chlorobutyl)furan |
| PubChem CID | 64514685 |
| Molecular Formula | C8H11ClO |
| Molecular Weight | 158.63 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 3-(3-chlorobutyl)furan |
| SMILES | CC(Cl)CCc1ccoc1 |
| InChI | InChI=1S/C8H11ClO/c1-7(9)2-3-8-4-5-10-6-8/h4-7H,2-3H2,1H3 |
| InChIKey | FGSFPTDLXPZROZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.63 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-chlorobutyl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chlorobutyl)furan?
The IUPAC name of 3-(3-chlorobutyl)furan (CID 64514685) is 3-(3-chlorobutyl)furan.
What is the SMILES notation for 3-(3-chlorobutyl)furan?
The canonical SMILES for 3-(3-chlorobutyl)furan is CC(Cl)CCc1ccoc1.
What is the InChIKey of 3-(3-chlorobutyl)furan?
The InChIKey is FGSFPTDLXPZROZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClO/c1-7(9)2-3-8-4-5-10-6-8/h4-7H,2-3H2,1H3.
What are the key properties of 3-(3-chlorobutyl)furan?
3-(3-chlorobutyl)furan has a molecular weight of 158.63 g/mol, XLogP of 2.84, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chlorobutyl)furan is sourced from PubChem (CID 64514685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).