C21H30O5 — CID 163190033
(2S)-3-[(E,4R,6R)-11-(furan-3-yl)-6-hydroxy-4,8-dimethylundec-8-enyl]-2-hydroxy-2H-furan-5-one (PubChem CID 163190033) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is (2S)-3-[(E,4R,6R)-11-(furan-3-yl)-6-hydroxy-4,8-dimethylundec-8-enyl]-2-hydroxy-2H-furan-5-one.
| Compound Name | (2S)-3-[(E,4R,6R)-11-(furan-3-yl)-6-hydroxy-4,8-dimethylundec-8-enyl]-2-hydroxy-2H-furan-5-one |
|---|---|
| PubChem CID | 163190033 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (2S)-3-[(E,4R,6R)-11-(furan-3-yl)-6-hydroxy-4,8-dimethylundec-8-enyl]-2-hydroxy-2H-furan-5-one |
| SMILES | C/C(=C\CCc1ccoc1)C[C@H](O)C[C@H](C)CCCC1=CC(=O)O[C@@H]1O |
| InChI | InChI=1S/C21H30O5/c1-15(5-3-7-17-9-10-25-14-17)11-19(22)12-16(2)6-4-8-18-13-20(23)26-21(18)24/h5,9-10,13-14,16,19,21-22,24H,3-4,6-8,11-12H2,1-2H3/b15-5+/t16-,19+,21+/m1/s1 |
| InChIKey | BUUWGAHLHPTCTL-NCWGSNCHSA-N |
| XLogP | 3.91 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|