C27H42O7 — CID 74336989
dimethyl 2-[13-(furan-3-yl)-2,6,10-trimethyltrideca-5,10-dienyl]-2,3-dihydroxy-3-methylbutanedioate (PubChem CID 74336989) has the molecular formula C27H42O7 and a molecular weight of 478.63 g/mol. Its IUPAC name is dimethyl 2-[13-(furan-3-yl)-2,6,10-trimethyltrideca-5,10-dienyl]-2,3-dihydroxy-3-methylbutanedioate.
| Compound Name | dimethyl 2-[13-(furan-3-yl)-2,6,10-trimethyltrideca-5,10-dienyl]-2,3-dihydroxy-3-methylbutanedioate |
|---|---|
| PubChem CID | 74336989 |
| Molecular Formula | C27H42O7 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | dimethyl 2-[13-(furan-3-yl)-2,6,10-trimethyltrideca-5,10-dienyl]-2,3-dihydroxy-3-methylbutanedioate |
| SMILES | COC(=O)C(C)(O)C(O)(CC(C)CCC=C(C)CCCC(C)=CCCc1ccoc1)C(=O)OC |
| InChI | InChI=1S/C27H42O7/c1-20(10-7-11-21(2)13-9-15-23-16-17-34-19-23)12-8-14-22(3)18-27(31,25(29)33-6)26(4,30)24(28)32-5/h12-13,16-17,19,22,30-31H,7-11,14-15,18H2,1-6H3 |
| InChIKey | MHRVDVNDBGMQTP-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|