C27H40O4 — CID 162884591
[(1S)-1-(furan-3-yl)-4,8,12,16-tetramethyl-14-oxoheptadeca-3,7,11-trienyl] acetate (PubChem CID 162884591) has the molecular formula C27H40O4 and a molecular weight of 428.61 g/mol. Its IUPAC name is [(1S)-1-(furan-3-yl)-4,8,12,16-tetramethyl-14-oxoheptadeca-3,7,11-trienyl] acetate.
| Compound Name | [(1S)-1-(furan-3-yl)-4,8,12,16-tetramethyl-14-oxoheptadeca-3,7,11-trienyl] acetate |
|---|---|
| PubChem CID | 162884591 |
| Molecular Formula | C27H40O4 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | [(1S)-1-(furan-3-yl)-4,8,12,16-tetramethyl-14-oxoheptadeca-3,7,11-trienyl] acetate |
| SMILES | CC(=O)O[C@@H](CC=C(C)CCC=C(C)CCC=C(C)CC(=O)CC(C)C)c1ccoc1 |
| InChI | InChI=1S/C27H40O4/c1-20(2)17-26(29)18-23(5)12-8-10-21(3)9-7-11-22(4)13-14-27(31-24(6)28)25-15-16-30-19-25/h9,12-13,15-16,19-20,27H,7-8,10-11,14,17-18H2,1-6H3/t27-/m0/s1 |
| InChIKey | IRBWUUAXBAPQRQ-MHZLTWQESA-N |
| XLogP | 7.68 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|