C20H28O4 — CID 162932600
[(2S)-3-methylidenefuran-2-yl] (2E,6E)-3,7,11-trimethyl-9-oxododeca-2,6-dienoate (PubChem CID 162932600) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is [(2S)-3-methylidenefuran-2-yl] (2E,6E)-3,7,11-trimethyl-9-oxododeca-2,6-dienoate.
| Compound Name | [(2S)-3-methylidenefuran-2-yl] (2E,6E)-3,7,11-trimethyl-9-oxododeca-2,6-dienoate |
|---|---|
| PubChem CID | 162932600 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | [(2S)-3-methylidenefuran-2-yl] (2E,6E)-3,7,11-trimethyl-9-oxododeca-2,6-dienoate |
| SMILES | C=C1C=CO[C@H]1OC(=O)/C=C(\C)CC/C=C(\C)CC(=O)CC(C)C |
| InChI | InChI=1S/C20H28O4/c1-14(2)11-18(21)12-15(3)7-6-8-16(4)13-19(22)24-20-17(5)9-10-23-20/h7,9-10,13-14,20H,5-6,8,11-12H2,1-4H3/b15-7+,16-13+/t20-/m0/s1 |
| InChIKey | IDGKIEFBABVJOG-QQEJEERHSA-N |
| XLogP | 4.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|