C16H19NO2S2 — CID 101352601
O-ethyl [(6S)-2-oxo-1-phenyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-6-yl]sulfanylmethanethioate (PubChem CID 101352601) has the molecular formula C16H19NO2S2 and a molecular weight of 321.47 g/mol. Its IUPAC name is O-ethyl [(6S)-2-oxo-1-phenyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-6-yl]sulfanylmethanethioate.
| Compound Name | O-ethyl [(6S)-2-oxo-1-phenyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-6-yl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 101352601 |
| Molecular Formula | C16H19NO2S2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | O-ethyl [(6S)-2-oxo-1-phenyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrol-6-yl]sulfanylmethanethioate |
| SMILES | CCOC(=S)S[C@H]1CCC2CC(=O)N(c3ccccc3)C21 |
| InChI | InChI=1S/C16H19NO2S2/c1-2-19-16(20)21-13-9-8-11-10-14(18)17(15(11)13)12-6-4-3-5-7-12/h3-7,11,13,15H,2,8-10H2,1H3/t11?,13-,15?/m0/s1 |
| InChIKey | SISGYRVSFMJYAA-QRJNDHJOSA-N |
| XLogP | 3.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|