C24H23N3O3 — CID 102027595
ethyl 4-anilino-5-oxo-1,3-diphenylimidazolidine-2-carboxylate (PubChem CID 102027595) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is ethyl 4-anilino-5-oxo-1,3-diphenylimidazolidine-2-carboxylate.
| Compound Name | ethyl 4-anilino-5-oxo-1,3-diphenylimidazolidine-2-carboxylate |
|---|---|
| PubChem CID | 102027595 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | ethyl 4-anilino-5-oxo-1,3-diphenylimidazolidine-2-carboxylate |
| SMILES | CCOC(=O)C1N(c2ccccc2)C(=O)C(Nc2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C24H23N3O3/c1-2-30-24(29)22-26(19-14-8-4-9-15-19)21(25-18-12-6-3-7-13-18)23(28)27(22)20-16-10-5-11-17-20/h3-17,21-22,25H,2H2,1H3 |
| InChIKey | RYVYDPKZERLNCG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |