C16H16ClN3O2 — CID 97305011
ethyl (2S)-4-chloro-3-methyl-1-phenyl-2H-pyrrolo[2,3-d]pyrimidine-2-carboxylate (PubChem CID 97305011) has the molecular formula C16H16ClN3O2 and a molecular weight of 317.78 g/mol. Its IUPAC name is ethyl (2S)-4-chloro-3-methyl-1-phenyl-2H-pyrrolo[2,3-d]pyrimidine-2-carboxylate.
| Compound Name | ethyl (2S)-4-chloro-3-methyl-1-phenyl-2H-pyrrolo[2,3-d]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 97305011 |
| Molecular Formula | C16H16ClN3O2 |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | ethyl (2S)-4-chloro-3-methyl-1-phenyl-2H-pyrrolo[2,3-d]pyrimidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1N(C)C(Cl)=C2C=CN=C2N1c1ccccc1 |
| InChI | InChI=1S/C16H16ClN3O2/c1-3-22-16(21)15-19(2)13(17)12-9-10-18-14(12)20(15)11-7-5-4-6-8-11/h4-10,15H,3H2,1-2H3/t15-/m1/s1 |
| InChIKey | HIFLQJSFBLYGEQ-OAHLLOKOSA-N |
| XLogP | 2.70 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|