C12H13NO3 — CID 124510271
(2R,3R)-2-methyl-5-oxo-1-phenylpyrrolidine-3-carboxylic acid (PubChem CID 124510271) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is (2R,3R)-2-methyl-5-oxo-1-phenylpyrrolidine-3-carboxylic acid.
| Compound Name | (2R,3R)-2-methyl-5-oxo-1-phenylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 124510271 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (2R,3R)-2-methyl-5-oxo-1-phenylpyrrolidine-3-carboxylic acid |
| SMILES | C[C@@H]1[C@H](C(=O)O)CC(=O)N1c1ccccc1 |
| InChI | InChI=1S/C12H13NO3/c1-8-10(12(15)16)7-11(14)13(8)9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3,(H,15,16)/t8-,10-/m1/s1 |
| InChIKey | YHQRDMJIMOWCMU-PSASIEDQSA-N |
| XLogP | 1.51 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |