C15H18N2O4 — CID 107811853
1-(3-carbamoylphenyl)-2,4-dimethyl-6-oxopiperidine-3-carboxylic acid (PubChem CID 107811853) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 1-(3-carbamoylphenyl)-2,4-dimethyl-6-oxopiperidine-3-carboxylic acid.
| Compound Name | 1-(3-carbamoylphenyl)-2,4-dimethyl-6-oxopiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 107811853 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 1-(3-carbamoylphenyl)-2,4-dimethyl-6-oxopiperidine-3-carboxylic acid |
| SMILES | CC1CC(=O)N(c2cccc(C(N)=O)c2)C(C)C1C(=O)O |
| InChI | InChI=1S/C15H18N2O4/c1-8-6-12(18)17(9(2)13(8)15(20)21)11-5-3-4-10(7-11)14(16)19/h3-5,7-9,13H,6H2,1-2H3,(H2,16,19)(H,20,21) |
| InChIKey | CIWJQJAGPPMKQM-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |