C12H19NO2S2 — CID 101352598
O-ethyl [(1R,4S,5S)-6-ethyl-7-oxo-6-azabicyclo[3.2.1]octan-4-yl]sulfanylmethanethioate (PubChem CID 101352598) has the molecular formula C12H19NO2S2 and a molecular weight of 273.42 g/mol. Its IUPAC name is O-ethyl [(1R,4S,5S)-6-ethyl-7-oxo-6-azabicyclo[3.2.1]octan-4-yl]sulfanylmethanethioate.
| Compound Name | O-ethyl [(1R,4S,5S)-6-ethyl-7-oxo-6-azabicyclo[3.2.1]octan-4-yl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 101352598 |
| Molecular Formula | C12H19NO2S2 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | O-ethyl [(1R,4S,5S)-6-ethyl-7-oxo-6-azabicyclo[3.2.1]octan-4-yl]sulfanylmethanethioate |
| SMILES | CCOC(=S)S[C@H]1CC[C@@H]2C[C@@H]1N(CC)C2=O |
| InChI | InChI=1S/C12H19NO2S2/c1-3-13-9-7-8(11(13)14)5-6-10(9)17-12(16)15-4-2/h8-10H,3-7H2,1-2H3/t8-,9+,10+/m1/s1 |
| InChIKey | BJOCJVMFBJWTCJ-UTLUCORTSA-N |
| XLogP | 2.44 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|