C11H18N2O2 — CID 103549504
3-(2-aminobutyl)-3-azabicyclo[3.2.1]octane-2,4-dione (PubChem CID 103549504) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-(2-aminobutyl)-3-azabicyclo[3.2.1]octane-2,4-dione.
| Compound Name | 3-(2-aminobutyl)-3-azabicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 103549504 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 3-(2-aminobutyl)-3-azabicyclo[3.2.1]octane-2,4-dione |
| SMILES | CCC(N)CN1C(=O)C2CCC(C2)C1=O |
| InChI | InChI=1S/C11H18N2O2/c1-2-9(12)6-13-10(14)7-3-4-8(5-7)11(13)15/h7-9H,2-6,12H2,1H3 |
| InChIKey | UTAPRBAFCOWIGK-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|