C10H15NO4 — CID 103552325
3-(2,3-dihydroxypropyl)-3-azabicyclo[3.2.1]octane-2,4-dione (PubChem CID 103552325) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropyl)-3-azabicyclo[3.2.1]octane-2,4-dione.
| Compound Name | 3-(2,3-dihydroxypropyl)-3-azabicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 103552325 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 3-(2,3-dihydroxypropyl)-3-azabicyclo[3.2.1]octane-2,4-dione |
| SMILES | O=C1C2CCC(C2)C(=O)N1CC(O)CO |
| InChI | InChI=1S/C10H15NO4/c12-5-8(13)4-11-9(14)6-1-2-7(3-6)10(11)15/h6-8,12-13H,1-5H2 |
| InChIKey | IZWNKYOQQLTVAQ-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|