C10H18N2O6 — CID 139972938
1,4-bis(2,3-dihydroxypropyl)piperazine-2,3-dione (PubChem CID 139972938) has the molecular formula C10H18N2O6 and a molecular weight of 262.26 g/mol. Its IUPAC name is 1,4-bis(2,3-dihydroxypropyl)piperazine-2,3-dione.
| Compound Name | 1,4-bis(2,3-dihydroxypropyl)piperazine-2,3-dione |
|---|---|
| PubChem CID | 139972938 |
| Molecular Formula | C10H18N2O6 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 1,4-bis(2,3-dihydroxypropyl)piperazine-2,3-dione |
| SMILES | O=C1C(=O)N(CC(O)CO)CCN1CC(O)CO |
| InChI | InChI=1S/C10H18N2O6/c13-5-7(15)3-11-1-2-12(4-8(16)6-14)10(18)9(11)17/h7-8,13-16H,1-6H2 |
| InChIKey | GPYDDOJKYSBCRU-UHFFFAOYSA-N |
| XLogP | -3.64 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | -3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|