C7H13NO3 — CID 67368319
1-(2,3-dihydroxypropyl)pyrrolidin-3-one (PubChem CID 67368319) has the molecular formula C7H13NO3 and a molecular weight of 159.19 g/mol. Its IUPAC name is 1-(2,3-dihydroxypropyl)pyrrolidin-3-one.
| Compound Name | 1-(2,3-dihydroxypropyl)pyrrolidin-3-one |
|---|---|
| PubChem CID | 67368319 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 1-(2,3-dihydroxypropyl)pyrrolidin-3-one |
| SMILES | O=C1CCN(CC(O)CO)C1 |
| InChI | InChI=1S/C7H13NO3/c9-5-7(11)4-8-2-1-6(10)3-8/h7,9,11H,1-5H2 |
| InChIKey | SNFPWORTHCUOQU-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |