C9H17NO3 — CID 114500290
1-(2,3-dihydroxypropyl)-3-methylpiperidin-4-one (PubChem CID 114500290) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is 1-(2,3-dihydroxypropyl)-3-methylpiperidin-4-one.
| Compound Name | 1-(2,3-dihydroxypropyl)-3-methylpiperidin-4-one |
|---|---|
| PubChem CID | 114500290 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 1-(2,3-dihydroxypropyl)-3-methylpiperidin-4-one |
| SMILES | CC1CN(CC(O)CO)CCC1=O |
| InChI | InChI=1S/C9H17NO3/c1-7-4-10(3-2-9(7)13)5-8(12)6-11/h7-8,11-12H,2-6H2,1H3 |
| InChIKey | MPEOTKPNZDXPLY-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |