C7H15NO3 — CID 103857755
3-[(3R)-3-hydroxypyrrolidin-1-yl]propane-1,2-diol (PubChem CID 103857755) has the molecular formula C7H15NO3 and a molecular weight of 161.20 g/mol. Its IUPAC name is 3-[(3R)-3-hydroxypyrrolidin-1-yl]propane-1,2-diol.
| Compound Name | 3-[(3R)-3-hydroxypyrrolidin-1-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 103857755 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | 3-[(3R)-3-hydroxypyrrolidin-1-yl]propane-1,2-diol |
| SMILES | OCC(O)CN1CC[C@@H](O)C1 |
| InChI | InChI=1S/C7H15NO3/c9-5-7(11)4-8-2-1-6(10)3-8/h6-7,9-11H,1-5H2/t6-,7?/m1/s1 |
| InChIKey | LVNHFJFINQPLPD-ULUSZKPHSA-N |
| XLogP | -1.59 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |