C7H16N2O2 — CID 82850969
3-[(3R)-3-aminopyrrolidin-1-yl]propane-1,2-diol (PubChem CID 82850969) has the molecular formula C7H16N2O2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 3-[(3R)-3-aminopyrrolidin-1-yl]propane-1,2-diol.
| Compound Name | 3-[(3R)-3-aminopyrrolidin-1-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 82850969 |
| Molecular Formula | C7H16N2O2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.12 |
| IUPAC Name | 3-[(3R)-3-aminopyrrolidin-1-yl]propane-1,2-diol |
| SMILES | N[C@@H]1CCN(CC(O)CO)C1 |
| InChI | InChI=1S/C7H16N2O2/c8-6-1-2-9(3-6)4-7(11)5-10/h6-7,10-11H,1-5,8H2/t6-,7?/m1/s1 |
| InChIKey | NVGHTGJWLYBLSH-ULUSZKPHSA-N |
| XLogP | -1.63 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |