C8H15NO4 — CID 57486049
1-(2,3-dihydroxypropyl)pyrrolidine-3-carboxylic acid (PubChem CID 57486049) has the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. Its IUPAC name is 1-(2,3-dihydroxypropyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-(2,3-dihydroxypropyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 57486049 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 1-(2,3-dihydroxypropyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(CC(O)CO)C1 |
| InChI | InChI=1S/C8H15NO4/c10-5-7(11)4-9-2-1-6(3-9)8(12)13/h6-7,10-11H,1-5H2,(H,12,13) |
| InChIKey | ZEDVNFDCSYJCOQ-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |