1-(2,3-dihydroxypropyl)pyrrolidine-3-carboxylic acid

C8H15NO4 — CID 57486049

IUPAC1-(2,3-dihydroxypropyl)pyrrolidine-3-carboxylic acid
SMILESO=C(O)C1CCN(CC(O)CO)C1
InChIInChI=1S/C8H15NO4/c10-5-7(11)4-9-2-1-6(3-9)8(12)13/h6-7,10-11H,1-5H2,(H,12,13)
InChIKeyZEDVNFDCSYJCOQ-UHFFFAOYSA-N
MW189.21 g/mol
LogP-1.25
Rot. Bonds4

About 1-(2,3-dihydroxypropyl)pyrrolidine-3-carboxylic acid

1-(2,3-dihydroxypropyl)pyrrolidine-3-carboxylic acid (PubChem CID 57486049) has the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. Its IUPAC name is 1-(2,3-dihydroxypropyl)pyrrolidine-3-carboxylic acid.

Molecular Properties

Compound Name1-(2,3-dihydroxypropyl)pyrrolidine-3-carboxylic acid
PubChem CID57486049
Molecular FormulaC8H15NO4
Molecular Weight189.21 g/mol
Exact Mass189.10
IUPAC Name1-(2,3-dihydroxypropyl)pyrrolidine-3-carboxylic acid
SMILESO=C(O)C1CCN(CC(O)CO)C1
InChIInChI=1S/C8H15NO4/c10-5-7(11)4-9-2-1-6(3-9)8(12)13/h6-7,10-11H,1-5H2,(H,12,13)
InChIKeyZEDVNFDCSYJCOQ-UHFFFAOYSA-N
XLogP-1.25
TPSA81.00 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500189.21
LogP ≤ 5-1.25
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 1-(2,3-dihydroxypropyl)pyrrolidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2,3-dihydroxypropyl)pyrrolidine-3-carboxylic acid?
The IUPAC name of 1-(2,3-dihydroxypropyl)pyrrolidine-3-carboxylic acid (CID 57486049) is 1-(2,3-dihydroxypropyl)pyrrolidine-3-carboxylic acid.
What is the SMILES notation for 1-(2,3-dihydroxypropyl)pyrrolidine-3-carboxylic acid?
The canonical SMILES for 1-(2,3-dihydroxypropyl)pyrrolidine-3-carboxylic acid is O=C(O)C1CCN(CC(O)CO)C1.
What is the InChIKey of 1-(2,3-dihydroxypropyl)pyrrolidine-3-carboxylic acid?
The InChIKey is ZEDVNFDCSYJCOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO4/c10-5-7(11)4-9-2-1-6(3-9)8(12)13/h6-7,10-11H,1-5H2,(H,12,13).
What are the key properties of 1-(2,3-dihydroxypropyl)pyrrolidine-3-carboxylic acid?
1-(2,3-dihydroxypropyl)pyrrolidine-3-carboxylic acid has a molecular weight of 189.21 g/mol, XLogP of -1.25, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydroxypropyl)pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 57486049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).