C8H17NO2 — CID 854495
(2S)-3-piperidin-1-ylpropane-1,2-diol (PubChem CID 854495) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is (2S)-3-piperidin-1-ylpropane-1,2-diol.
| Compound Name | (2S)-3-piperidin-1-ylpropane-1,2-diol |
|---|---|
| PubChem CID | 854495 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | (2S)-3-piperidin-1-ylpropane-1,2-diol |
| SMILES | OC[C@@H](O)CN1CCCCC1 |
| InChI | InChI=1S/C8H17NO2/c10-7-8(11)6-9-4-2-1-3-5-9/h8,10-11H,1-7H2/t8-/m0/s1 |
| InChIKey | MECNWXGGNCJFQJ-QMMMGPOBSA-N |
| XLogP | -0.17 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |