C10H22N2O3 — CID 139832285
3-[4-(2-hydroxypropyl)piperazin-1-yl]propane-1,2-diol (PubChem CID 139832285) has the molecular formula C10H22N2O3 and a molecular weight of 218.30 g/mol. Its IUPAC name is 3-[4-(2-hydroxypropyl)piperazin-1-yl]propane-1,2-diol.
| Compound Name | 3-[4-(2-hydroxypropyl)piperazin-1-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 139832285 |
| Molecular Formula | C10H22N2O3 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | 3-[4-(2-hydroxypropyl)piperazin-1-yl]propane-1,2-diol |
| SMILES | CC(O)CN1CCN(CC(O)CO)CC1 |
| InChI | InChI=1S/C10H22N2O3/c1-9(14)6-11-2-4-12(5-3-11)7-10(15)8-13/h9-10,13-15H,2-8H2,1H3 |
| InChIKey | JGUBQJATNNBHOV-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |