C20H44FeN4O4+3 — CID 164850270
iron(3+);(2S)-1-[4,7,10-tris[(2S)-2-hydroxypropyl]-1,4,7,10-tetrazacyclododec-1-yl]propan-2-ol (PubChem CID 164850270) has the molecular formula C20H44FeN4O4+3 and a molecular weight of 460.44 g/mol. Its IUPAC name is iron(3+);(2S)-1-[4,7,10-tris[(2S)-2-hydroxypropyl]-1,4,7,10-tetrazacyclododec-1-yl]propan-2-ol.
| Compound Name | iron(3+);(2S)-1-[4,7,10-tris[(2S)-2-hydroxypropyl]-1,4,7,10-tetrazacyclododec-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 164850270 |
| Molecular Formula | C20H44FeN4O4+3 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | iron(3+);(2S)-1-[4,7,10-tris[(2S)-2-hydroxypropyl]-1,4,7,10-tetrazacyclododec-1-yl]propan-2-ol |
| SMILES | C[C@H](O)CN1CCN(C[C@H](C)O)CCN(C[C@H](C)O)CCN(C[C@H](C)O)CC1.[Fe+3] |
| InChI | InChI=1S/C20H44N4O4.Fe/c1-17(25)13-21-5-7-22(14-18(2)26)9-11-24(16-20(4)28)12-10-23(8-6-21)15-19(3)27;/h17-20,25-28H,5-16H2,1-4H3;/q;+3/t17-,18-,19-,20-;/m0./s1 |
| InChIKey | FABLGSKHEWMLAV-NAACWRBGSA-N |
| XLogP | -1.27 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|